CAS 873581-58-9 appears in our catalog under these names: 5-Phenylisoxazol-4-amine, 97%, 5-Phenyl-1,2-oxazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-phenyl-1,2-oxazol-4-amine (CAS 873581-58-9) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-phenyl-1,2-oxazol-4-amine. InChIKey: NZGAQXMCAGAMNR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazol-4-amine |
| InChIKey | NZGAQXMCAGAMNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NO2)N |
Computed by PubChem (NCBI)