CAS 873790-28-4 is the registry number for 2,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrrole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylic acid (CAS 873790-28-4) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylic acid. InChIKey: ZYOPSRRCTHKRMZ-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylic acid |
| InChIKey | ZYOPSRRCTHKRMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC(F)(F)F)C)C(=O)O |
Computed by PubChem (NCBI)