Products 873990-80-8
CAS 873990-80-8 is the registry number for 2-Nitro-p-anisidine-15N. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-methoxy-2-[oxido(oxo)(15N)(15N)azaniumyl](15N)aniline (CAS 873990-80-8) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 169.14 g/mol. IUPAC name: 4-methoxy-2-[oxido(oxo)(15N)(15N)azaniumyl](15N)aniline. InChIKey: QFMJFXFXQAFGBO-QBZHADDCSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 4-methoxy-2-[oxido(oxo)(15N)(15N)azaniumyl](15N)aniline |
| InChIKey | QFMJFXFXQAFGBO-QBZHADDCSA-N |
| SMILES | COC1=CC(=C(C=C1)N)[15N+](=O)[O-] |
Computed by PubChem (NCBI)