CAS 922730-95-8 is the registry number for 4-Methoxy-2-nitroaniline-d3. Offered by: TRC. Available pack sizes: 500mg, 50mg.
2-nitro-4-(trideuteriomethoxy)aniline (CAS 922730-95-8) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 171.17 g/mol. IUPAC name: 2-nitro-4-(trideuteriomethoxy)aniline. InChIKey: QFMJFXFXQAFGBO-FIBGUPNXSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 171.17 g/mol |
| IUPAC name | 2-nitro-4-(trideuteriomethoxy)aniline |
| InChIKey | QFMJFXFXQAFGBO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)