Products 87441-73-4
CAS 87441-73-4 appears in our catalog under these names: 11(13)-Dehydroivaxillin, (-)-11,13-Dehydroeriolin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
5,10-dimethyl-15-methylidene-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-14-one (CAS 87441-73-4) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: 5,10-dimethyl-15-methylidene-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-14-one. InChIKey: SSZZFAJCDFWCJW-UHFFFAOYSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 5,10-dimethyl-15-methylidene-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadecan-14-one |
| InChIKey | SSZZFAJCDFWCJW-UHFFFAOYSA-N |
| SMILES | CC12CCC3C(O3)(CC4C(CC1O2)C(=C)C(=O)O4)C |
Computed by PubChem (NCBI)