Products 874523-27-0
CAS 874523-27-0 is the registry number for 4-(2-Bromoethyl)-N,N-dimethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2-bromoethyl)-N,N-dimethylbenzenesulfonamide (CAS 874523-27-0) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 4-(2-bromoethyl)-N,N-dimethylbenzenesulfonamide. InChIKey: NONGMEMNSDZFCY-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 4-(2-bromoethyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | NONGMEMNSDZFCY-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)CCBr |
Computed by PubChem (NCBI)