Products 874623-15-1
CAS 874623-15-1 is the registry number for N-Ethyl-N-(4-formyl-1,3-thiazol-2-yl)acetamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-ethyl-N-(4-formyl-1,3-thiazol-2-yl)acetamide (CAS 874623-15-1) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: N-ethyl-N-(4-formyl-1,3-thiazol-2-yl)acetamide. InChIKey: XAHVCILBDCZWKV-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | N-ethyl-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
| InChIKey | XAHVCILBDCZWKV-UHFFFAOYSA-N |
| SMILES | CCN(C1=NC(=CS1)C=O)C(=O)C |
Computed by PubChem (NCBI)