Products 874623-36-6
CAS 874623-36-6 appears in our catalog under these names: 3-[(2-Methyl-1,3-thiazol-4-yl)methoxy]benzoic acid, 95%, 3-((2-Methyl-1,3-thiazol-4-yl)methoxy)benzoic acid, 95%, 3-((2-Methyl-1,3-thiazol-4-yl)methoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoic acid (CAS 874623-36-6) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoic acid. InChIKey: AKSSOQQGEAWRTP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 3-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoic acid |
| InChIKey | AKSSOQQGEAWRTP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)COC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)