Products 874657-46-2
CAS 874657-46-2 appears in our catalog under these names: 1,3-Dimethoxy-1,3-dihydroisobenzofuran-5-carboxylic acid, 98%, 98%, 1,3-Dimethoxy-1,3-dihydroisobenzofuran-5-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS 874657-46-2) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylic acid. InChIKey: BLHKHNFFQYQOCM-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylic acid |
| InChIKey | BLHKHNFFQYQOCM-UHFFFAOYSA-N |
| SMILES | COC1C2=C(C=C(C=C2)C(=O)O)C(O1)OC |
Computed by PubChem (NCBI)