CAS 874908-44-8 appears in our catalog under these names: 3-Cyclohexyl-1h-pyrazole-4-carboxylic acid, 95%, 3-Cyclohexyl-1H-pyrazole-4-carboxylic acid, 3-Cyclohexyl-1H-pyrazole-4-carboxylic acid, ≥97%, ≥97%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 2,5g, 250mg.
5-cyclohexyl-1H-pyrazole-4-carboxylic acid (CAS 874908-44-8) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 5-cyclohexyl-1H-pyrazole-4-carboxylic acid. InChIKey: MOCBJMTUHWKNAQ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-cyclohexyl-1H-pyrazole-4-carboxylic acid |
| InChIKey | MOCBJMTUHWKNAQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C=NN2)C(=O)O |
Computed by PubChem (NCBI)