CAS 875160-31-9 is the registry number for 4-Methyl-2-(4-methylphenoxymethyl)-1,3-thiazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 10g.
4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylic acid (CAS 875160-31-9) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: 4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylic acid. InChIKey: SEGXHAGGSWSNIR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | 4-methyl-2-[(4-methylphenoxy)methyl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | SEGXHAGGSWSNIR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OCC2=NC(=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)