Products 87545-71-9
CAS 87545-71-9 is the registry number for 3-(tert-Butoxy)-2-methoxy-3-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-methoxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (CAS 87545-71-9) is a chemical compound with the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. IUPAC name: 2-methoxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid. InChIKey: GYIFQIIXFNIGSW-UHFFFAOYSA-N.
| Molecular formula | C8H14O5 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 2-methoxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| InChIKey | GYIFQIIXFNIGSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C(=O)O)OC |
Computed by PubChem (NCBI)