CAS 876-93-7 appears in our catalog under these names: 1-Phenyl-1h-pyrazol-5-ol, 95%, 1–Phenyl–1H–pyrazol–5–ol, 1-Phenyl-1H-pyrazol-5-ol. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 2,5g.
2-phenyl-1H-pyrazol-3-one (CAS 876-93-7) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 2-phenyl-1H-pyrazol-3-one. InChIKey: ILPGQKHPPSSCBS-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 2-phenyl-1H-pyrazol-3-one |
| InChIKey | ILPGQKHPPSSCBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=CN2 |
Computed by PubChem (NCBI)