Products 876126-59-9
CAS 876126-59-9 is the registry number for 3-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide. Offered by: Chemat. Available pack sizes: 1g.
3-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide (CAS 876126-59-9) is a chemical compound with the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. IUPAC name: 3-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide. InChIKey: VMXVRIYTWVAOEC-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O4 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | 3-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide |
| InChIKey | VMXVRIYTWVAOEC-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)NC(=O)C2=CC(=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)