Products 876353-79-6
CAS 876353-79-6 is the registry number for tert-butyl (2,3-dimethylphenyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(2,3-dimethylphenyl)carbamate (CAS 876353-79-6) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: tert-butyl N-(2,3-dimethylphenyl)carbamate. InChIKey: MRXTVABFONUBDK-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | tert-butyl N-(2,3-dimethylphenyl)carbamate |
| InChIKey | MRXTVABFONUBDK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)