Products 87639-57-4
CAS 87639-57-4 appears in our catalog under these names: Dimethyl 4–bromophthalate, Dimethyl 4-bromophthalate 98%, Dimethyl 4-bromophthalate, 98%, Dimethyl 4-bromophthalate, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
Dimethyl 4-bromobenzene-1,2-dicarboxylate (CAS 87639-57-4) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: dimethyl 4-bromobenzene-1,2-dicarboxylate. InChIKey: AMNIKUDFXYWYSY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | dimethyl 4-bromobenzene-1,2-dicarboxylate |
| InChIKey | AMNIKUDFXYWYSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)