CAS 876942-27-7 is the registry number for 3-Allyl-5,6-dimethoxy-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethoxy-3-prop-2-enyl-1H-indole (CAS 876942-27-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 5,6-dimethoxy-3-prop-2-enyl-1H-indole. InChIKey: SKLABUDCRKXBJQ-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5,6-dimethoxy-3-prop-2-enyl-1H-indole |
| InChIKey | SKLABUDCRKXBJQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CN2)CC=C)OC |
Computed by PubChem (NCBI)