CAS 877041-27-5 is the registry number for Ethyl 1-ethyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Ethyl 1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxylate (CAS 877041-27-5) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: ethyl 1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxylate. InChIKey: YJSLEHIQMWIZTO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | ethyl 1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxylate |
| InChIKey | YJSLEHIQMWIZTO-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C(=O)OCC)NC(=O)C1=O |
Computed by PubChem (NCBI)