CAS 877820-49-0 is the registry number for 1-(2-(5-Bromo-2-methoxyphenyl)-4-methylthiazol-5-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(5-bromo-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethanone (CAS 877820-49-0) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: 1-[2-(5-bromo-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethanone. InChIKey: FSSWLSLJMGFYQR-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2S |
|---|---|
| Molecular weight | 326.21 g/mol |
| IUPAC name | 1-[2-(5-bromo-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethanone |
| InChIKey | FSSWLSLJMGFYQR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=C(C=CC(=C2)Br)OC)C(=O)C |
Computed by PubChem (NCBI)