Products 878217-73-3
CAS 878217-73-3 is the registry number for 4-(8-Methyl-4-oxo-3,4-dihydroquinazolin-3-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(8-methyl-4-oxoquinazolin-3-yl)butanoic acid (CAS 878217-73-3) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 4-(8-methyl-4-oxoquinazolin-3-yl)butanoic acid. InChIKey: CCBNXKHQIYFBSE-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 4-(8-methyl-4-oxoquinazolin-3-yl)butanoic acid |
| InChIKey | CCBNXKHQIYFBSE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)N(C=N2)CCCC(=O)O |
Computed by PubChem (NCBI)