CAS 878453-66-8 is the registry number for 7-(Propan-2-yl)-(1,2,4)triazolo(1,5-a)pyrimidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 878453-66-8) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: NCBNAZDSHQXLRS-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid |
| InChIKey | NCBNAZDSHQXLRS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC2=NC=NN12)C(=O)O |
Computed by PubChem (NCBI)