Products 878453-66-8

CAS 878453-66-8 is the registry number for 7-(Propan-2-yl)-(1,2,4)triazolo(1,5-a)pyrimidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 878453-66-8) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: NCBNAZDSHQXLRS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N4O2
Molecular weight206.20 g/mol
IUPAC name7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid
InChIKeyNCBNAZDSHQXLRS-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=NC2=NC=NN12)C(=O)O

Computed by PubChem (NCBI)