CAS 87891-60-9 appears in our catalog under these names: 7-Hydroxy-3-phenoxy-4H-chromen-4-one, 95%, 7-Hydroxy-3-phenoxy-4H-chromen-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
7-hydroxy-3-phenoxychromen-4-one (CAS 87891-60-9) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 7-hydroxy-3-phenoxychromen-4-one. InChIKey: RQYBXCFFANHJGM-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 7-hydroxy-3-phenoxychromen-4-one |
| InChIKey | RQYBXCFFANHJGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=COC3=C(C2=O)C=CC(=C3)O |
Computed by PubChem (NCBI)