Products 879132-34-0
CAS 879132-34-0 is the registry number for 5-Amino-1,3-dihydrospiro[indene-2,3'-pyrrolidin]-2'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-aminospiro[1,3-dihydroindene-2,3'-pyrrolidine]-2'-one (CAS 879132-34-0) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 5-aminospiro[1,3-dihydroindene-2,3'-pyrrolidine]-2'-one. InChIKey: XFGKSNMIKXQQPU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 5-aminospiro[1,3-dihydroindene-2,3'-pyrrolidine]-2'-one |
| InChIKey | XFGKSNMIKXQQPU-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C12CC3=C(C2)C=C(C=C3)N |
Computed by PubChem (NCBI)