CAS 879887-28-2 appears in our catalog under these names: 6-Bromo-2-ethyl-3,4-dihydroisoquinolin-1(2H)-one, 98%, 6–Bromo–2–ethyl–3,4–dihydroisoquinolin–1(2H)–one. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
6-bromo-2-ethyl-3,4-dihydroisoquinolin-1-one (CAS 879887-28-2) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 6-bromo-2-ethyl-3,4-dihydroisoquinolin-1-one. InChIKey: DBQTUYAUXWZURN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 6-bromo-2-ethyl-3,4-dihydroisoquinolin-1-one |
| InChIKey | DBQTUYAUXWZURN-UHFFFAOYSA-N |
| SMILES | CCN1CCC2=C(C1=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)