CAS 879896-49-8 is the registry number for (1-Methyl-3-thien-2-yl-1H-pyrazol-5-yl)methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
(1-methyl-3-thiophen-2-ylpyrazol-5-yl)methanol (CAS 879896-49-8) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: (1-methyl-3-thiophen-2-ylpyrazol-5-yl)methanol. InChIKey: CHKYTDUITSTBNJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | (1-methyl-3-thiophen-2-ylpyrazol-5-yl)methanol |
| InChIKey | CHKYTDUITSTBNJ-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=CS2)CO |
Computed by PubChem (NCBI)