Products 880478-98-8
CAS 880478-98-8 is the registry number for (2S)-3-(4-Hydroxyphenyl)-2-(3-methylbutanamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-3-(4-hydroxyphenyl)-2-(3-methylbutanoylamino)propanoic acid (CAS 880478-98-8) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-(3-methylbutanoylamino)propanoic acid. InChIKey: OFBAKOZWMFQFIW-LBPRGKRZSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-(3-methylbutanoylamino)propanoic acid |
| InChIKey | OFBAKOZWMFQFIW-LBPRGKRZSA-N |
| SMILES | CC(C)CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)