CAS 88057-19-6 appears in our catalog under these names: 1-(4-Nitrophenyl)ethane-1,2-diol, 98%, 4-Nitrophenyl-ethyleneglycol, 1-(4-Nitrophenyl)ethane-1,2-diol, 95+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 1g, 25g, 10g.
1-(4-nitrophenyl)ethane-1,2-diol (CAS 88057-19-6) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 1-(4-nitrophenyl)ethane-1,2-diol. InChIKey: YOJHBFHEOQUUAR-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1-(4-nitrophenyl)ethane-1,2-diol |
| InChIKey | YOJHBFHEOQUUAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CO)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)