Products 881040-29-5
CAS 881040-29-5 appears in our catalog under these names: Dimethyl 1H-indole-2,6-dicarboxylate, 97%, 97%, Dimethyl 1H-indole-2,6-dicarboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Dimethyl 1H-indole-2,6-dicarboxylate (CAS 881040-29-5) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: dimethyl 1H-indole-2,6-dicarboxylate. InChIKey: WBAMUOTUHSKBPC-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | dimethyl 1H-indole-2,6-dicarboxylate |
| InChIKey | WBAMUOTUHSKBPC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(N2)C(=O)OC |
Computed by PubChem (NCBI)