CAS 88153-50-8 is the registry number for 7-Methoxy-5,2',5'-trihydroxy-4-phenylcoumarin. Offered by: TRC. Available pack sizes: 250mg.
4-(2,5-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-2-one (CAS 88153-50-8) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 4-(2,5-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-2-one. InChIKey: SLKYVJWZJRRXFL-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 4-(2,5-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-2-one |
| InChIKey | SLKYVJWZJRRXFL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=CC(=O)OC2=C1)C3=C(C=CC(=C3)O)O)O |
Computed by PubChem (NCBI)