Products 88170-04-1
CAS 88170-04-1 appears in our catalog under these names: 4-(Cyano(phenyl)methylamino)benzoic acid, 95%, 4-(N-Benzylcyanamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-[[cyano(phenyl)methyl]amino]benzoic acid (CAS 88170-04-1) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 4-[[cyano(phenyl)methyl]amino]benzoic acid. InChIKey: VCPZKKYPOBDPMR-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-[[cyano(phenyl)methyl]amino]benzoic acid |
| InChIKey | VCPZKKYPOBDPMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C#N)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)