Products 882980-76-9
CAS 882980-76-9 appears in our catalog under these names: Methyl 3-methyl-4-sulfamoylbenzoate, 95%, Methyl 3-methyl-4-sulfamoylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 3-methyl-4-sulfamoylbenzoate (CAS 882980-76-9) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: methyl 3-methyl-4-sulfamoylbenzoate. InChIKey: JWKLJSNFTQZXAR-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | methyl 3-methyl-4-sulfamoylbenzoate |
| InChIKey | JWKLJSNFTQZXAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)S(=O)(=O)N |
Computed by PubChem (NCBI)