Products 883107-39-9

CAS 883107-39-9 is the registry number for 3-(4-Chlorophenyl)isonicotinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-chlorophenyl)pyridine-4-carboxylic acid (CAS 883107-39-9) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 3-(4-chlorophenyl)pyridine-4-carboxylic acid. InChIKey: LAOMBDDCLXTVHW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClNO2
Molecular weight233.65 g/mol
IUPAC name3-(4-chlorophenyl)pyridine-4-carboxylic acid
InChIKeyLAOMBDDCLXTVHW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(C=CN=C2)C(=O)O)Cl

Computed by PubChem (NCBI)