CAS 883194-93-2 appears in our catalog under these names: 4-(4-Nitro-phenyl)-piperidine hydrochloride, 95%, 4-(4-Nitrophenyl)piperidine hydrochloride, 95%, 4–(4–NITRO–PHENYL)–PIPERIDINE HYDROCHLORIDE, 4-(4-Nitrophenyl)piperidine hydrochloride, 4-(4-Nitro-phenyl)-piperidine, HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g.
4-(4-nitrophenyl)piperidine;hydrochloride (CAS 883194-93-2) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-(4-nitrophenyl)piperidine;hydrochloride. InChIKey: BGXQRDRUCGIGKN-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-(4-nitrophenyl)piperidine;hydrochloride |
| InChIKey | BGXQRDRUCGIGKN-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)