CAS 883527-60-4 appears in our catalog under these names: 4-(3-Bromophenyl)oxazole, 95%, 4-(3-BROMO-PHENYL)-OXAZOLE, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
4-(3-bromophenyl)-1,3-oxazole (CAS 883527-60-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-(3-bromophenyl)-1,3-oxazole. InChIKey: VJXUSTRTDVCWSL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-(3-bromophenyl)-1,3-oxazole |
| InChIKey | VJXUSTRTDVCWSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=COC=N2 |
Computed by PubChem (NCBI)