CAS 883545-23-1 is the registry number for 2-(6-Amino-2-oxo-benzooxazol-3-yl)-N,N-dimethyl-acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-dimethylacetamide (CAS 883545-23-1) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-dimethylacetamide. InChIKey: ADYAHGMIHVGXIC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-(6-amino-2-oxo-1,3-benzoxazol-3-yl)-N,N-dimethylacetamide |
| InChIKey | ADYAHGMIHVGXIC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN1C2=C(C=C(C=C2)N)OC1=O |
Computed by PubChem (NCBI)