CAS 883549-92-6 is the registry number for 3-(5,7-Dimethyl-1H-benzoimidazol-2-yl)-propionic acid. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg.
3-(4,6-dimethyl-1H-benzimidazol-2-yl)propanoic acid (CAS 883549-92-6) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 3-(4,6-dimethyl-1H-benzimidazol-2-yl)propanoic acid. InChIKey: GWBPWCASJGEFLO-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-(4,6-dimethyl-1H-benzimidazol-2-yl)propanoic acid |
| InChIKey | GWBPWCASJGEFLO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)NC(=N2)CCC(=O)O)C |
Computed by PubChem (NCBI)