Products 883554-97-0

CAS 883554-97-0 is the registry number for 4-(3-Aminobenzoyl)-piperazine-1-carboxylic acidt-butyl ester, 97%. Offered by: Fluorochem. Available pack sizes: 500mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(3-aminobenzoyl)piperazine-1-carboxylate (CAS 883554-97-0) is a chemical compound with the molecular formula C16H23N3O3 and a molecular weight of 305.37 g/mol. IUPAC name: tert-butyl 4-(3-aminobenzoyl)piperazine-1-carboxylate. InChIKey: MYWKOFOBSMSOHL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23N3O3
Molecular weight305.37 g/mol
IUPAC nametert-butyl 4-(3-aminobenzoyl)piperazine-1-carboxylate
InChIKeyMYWKOFOBSMSOHL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2=CC(=CC=C2)N

Computed by PubChem (NCBI)