CAS 884504-67-0 is the registry number for 2-((1-Bromo-2-naphthalenyl)oxy)-N-hydroxyethanimidamide. Offered by: Biosynth. Available pack sizes: 5000mg.
2-(1-bromonaphthalen-2-yl)oxy-N'-hydroxyethanimidamide (CAS 884504-67-0) is a chemical compound with the molecular formula C12H11BrN2O2 and a molecular weight of 295.13 g/mol. IUPAC name: 2-(1-bromonaphthalen-2-yl)oxy-N'-hydroxyethanimidamide. InChIKey: IILFGCHWLITFRT-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2 |
|---|---|
| Molecular weight | 295.13 g/mol |
| IUPAC name | 2-(1-bromonaphthalen-2-yl)oxy-N'-hydroxyethanimidamide |
| InChIKey | IILFGCHWLITFRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2Br)OC/C(=N/O)/N |
Computed by PubChem (NCBI)