Products 884507-29-3

CAS 884507-29-3 is the registry number for 2-Thiomorpholinoisonicotinic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-thiomorpholin-4-ylpyridine-4-carboxylic acid (CAS 884507-29-3) is a chemical compound with the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. IUPAC name: 2-thiomorpholin-4-ylpyridine-4-carboxylic acid. InChIKey: DDAWRDLRTZFVHD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O2S
Molecular weight224.28 g/mol
IUPAC name2-thiomorpholin-4-ylpyridine-4-carboxylic acid
InChIKeyDDAWRDLRTZFVHD-UHFFFAOYSA-N
SMILESC1CSCCN1C2=NC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)