Products 885-89-2
CAS 885-89-2 appears in our catalog under these names: 8-Methyl-2-phenylimidazo[1,2-a]pyridine, 98.0%, 8-Methyl-2-phenylimidazo[1,2-a]pyridine, >98.0%(GC). Offered by: Fluorochem, Chemat, TCI. Available pack sizes: 1g, 200mg.
8-methyl-2-phenylimidazo[1,2-a]pyridine (CAS 885-89-2) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 8-methyl-2-phenylimidazo[1,2-a]pyridine. InChIKey: CZYPXIUACURBEQ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 8-methyl-2-phenylimidazo[1,2-a]pyridine |
| InChIKey | CZYPXIUACURBEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)