Products 885266-80-8

CAS 885266-80-8 is the registry number for 1-Carbamoylmethyl-6-indolecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(2-amino-2-oxoethyl)indole-6-carboxylic acid (CAS 885266-80-8) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 1-(2-amino-2-oxoethyl)indole-6-carboxylic acid. InChIKey: SLQGXSJFDQXMTN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O3
Molecular weight218.21 g/mol
IUPAC name1-(2-amino-2-oxoethyl)indole-6-carboxylic acid
InChIKeySLQGXSJFDQXMTN-UHFFFAOYSA-N
SMILESC1=CC(=CC2=C1C=CN2CC(=O)N)C(=O)O

Computed by PubChem (NCBI)