Products 88527-18-8
CAS 88527-18-8 is the registry number for Mycoversilin. Offered by: MedChemExpress. Available pack sizes: Get quote.
8,11-dimethyl-1,12-dihydropyrano[3,2-a]xanthene-1,5,6,9,10,12-hexol (CAS 88527-18-8) is a chemical compound with the molecular formula C18H16O8 and a molecular weight of 360.3 g/mol. IUPAC name: 8,11-dimethyl-1,12-dihydropyrano[3,2-a]xanthene-1,5,6,9,10,12-hexol. InChIKey: CFHASEWULLWTPB-UHFFFAOYSA-N.
| Molecular formula | C18H16O8 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 8,11-dimethyl-1,12-dihydropyrano[3,2-a]xanthene-1,5,6,9,10,12-hexol |
| InChIKey | CFHASEWULLWTPB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(C3=C4C(C=COC4=C(C(=C3OC2=C(C(=C1O)O)C)O)O)O)O |
Computed by PubChem (NCBI)