CAS 885273-35-8 appears in our catalog under these names: 6-(Furan-2-yl)-1h-indole, 95%, 6-(Furan-2-yl)-1H-indole, 97%, 6-Furan-2-yl-1H-indole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 0,5g, 50mg.
6-(furan-2-yl)-1H-indole (CAS 885273-35-8) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 6-(furan-2-yl)-1H-indole. InChIKey: LKOMEJBHZIMBLT-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 6-(furan-2-yl)-1H-indole |
| InChIKey | LKOMEJBHZIMBLT-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC3=C(C=C2)C=CN3 |
Computed by PubChem (NCBI)