CAS 885274-35-1 appears in our catalog under these names: 2-(3-Bromo-phenyl)-oxazole, 95%, 2-(3-Bromophenyl)oxazole, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g.
2-(3-bromophenyl)-1,3-oxazole (CAS 885274-35-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 2-(3-bromophenyl)-1,3-oxazole. InChIKey: YLPWYXWXKUAHPU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,3-oxazole |
| InChIKey | YLPWYXWXKUAHPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC=CO2 |
Computed by PubChem (NCBI)