Products 885278-71-7
CAS 885278-71-7 appears in our catalog under these names: 7-Bromo-1H-indazole-3-carboxylic acid, 7-Bromo-1h-indazole-3-carboxylic acid, 98%, 7-Bromo-1H-indazole-3-carboxylic acid 97%, 7-Bromo-1H-indazole-3-carboxylic acid, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
7-bromo-2H-indazole-3-carboxylic acid (CAS 885278-71-7) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-2H-indazole-3-carboxylic acid. InChIKey: HJSGTNVPWFFHOJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-2H-indazole-3-carboxylic acid |
| InChIKey | HJSGTNVPWFFHOJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)