CAS 885371-64-2 is the registry number for 5-Ethoxy-1H-1,3-benzodiazol-2-amine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
6-ethoxy-1H-benzimidazol-2-amine (CAS 885371-64-2) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 6-ethoxy-1H-benzimidazol-2-amine. InChIKey: NZUORMKRSZZVPM-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 6-ethoxy-1H-benzimidazol-2-amine |
| InChIKey | NZUORMKRSZZVPM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N=C(N2)N |
Computed by PubChem (NCBI)