CAS 885461-16-5 is the registry number for N-(3-(2-Chloroacetyl)-2,4,6-trimethylphenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[3-(2-chloroacetyl)-2,4,6-trimethylphenyl]acetamide (CAS 885461-16-5) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: N-[3-(2-chloroacetyl)-2,4,6-trimethylphenyl]acetamide. InChIKey: BCEROUJKBXVEOK-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | N-[3-(2-chloroacetyl)-2,4,6-trimethylphenyl]acetamide |
| InChIKey | BCEROUJKBXVEOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)CCl)C)NC(=O)C)C |
Computed by PubChem (NCBI)