CAS 88551-85-3 appears in our catalog under these names: 2-Methylquinoline-5-sulfonic acid, Fasudil Impurity 24, 2-Methylquinoline-5-sulfonic acid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, Hubei YoungXin, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1x1ml.
2-methylquinoline-5-sulfonic acid (CAS 88551-85-3) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 2-methylquinoline-5-sulfonic acid. InChIKey: QZNQYKSCUCTMBZ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-methylquinoline-5-sulfonic acid |
| InChIKey | QZNQYKSCUCTMBZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)