Products 885519-78-8
CAS 885519-78-8 appears in our catalog under these names: 3-Formyl-1H-indazole-4-carboxylic acid, 3-FORMYL-4-INDAZOLECARBOXYLIC ACID, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 25g.
3-formyl-2H-indazole-4-carboxylic acid (CAS 885519-78-8) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-formyl-2H-indazole-4-carboxylic acid. InChIKey: DAPWQPGPGVUFLB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-formyl-2H-indazole-4-carboxylic acid |
| InChIKey | DAPWQPGPGVUFLB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)C(=O)O)C=O |
Computed by PubChem (NCBI)