Products 885519-90-4

CAS 885519-90-4 is the registry number for 4-Formyl-1H-indazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-formyl-1H-indazole-3-carboxylic acid (CAS 885519-90-4) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 4-formyl-1H-indazole-3-carboxylic acid. InChIKey: CAXPLHNPOMKHLU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O3
Molecular weight190.16 g/mol
IUPAC name4-formyl-1H-indazole-3-carboxylic acid
InChIKeyCAXPLHNPOMKHLU-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)NN=C2C(=O)O)C=O

Computed by PubChem (NCBI)